C11H14O2 — CID 125489280
(1R)-1-methoxy-7-methyl-3,4-dihydro-1H-isochromene (PubChem CID 125489280) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (1R)-1-methoxy-7-methyl-3,4-dihydro-1H-isochromene.
| Compound Name | (1R)-1-methoxy-7-methyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 125489280 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (1R)-1-methoxy-7-methyl-3,4-dihydro-1H-isochromene |
| SMILES | CO[C@@H]1OCCc2ccc(C)cc21 |
| InChI | InChI=1S/C11H14O2/c1-8-3-4-9-5-6-13-11(12-2)10(9)7-8/h3-4,7,11H,5-6H2,1-2H3/t11-/m1/s1 |
| InChIKey | SNQLLQIJDMTIRS-LLVKDONJSA-N |
| XLogP | 2.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |