C16H28O2 — CID 139814580
2,4-di(propan-2-yl)adamantane-2,4-diol (PubChem CID 139814580) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)adamantane-2,4-diol.
| Compound Name | 2,4-di(propan-2-yl)adamantane-2,4-diol |
|---|---|
| PubChem CID | 139814580 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2,4-di(propan-2-yl)adamantane-2,4-diol |
| SMILES | CC(C)C1(O)C2CC3CC(C2)C(O)(C(C)C)C1C3 |
| InChI | InChI=1S/C16H28O2/c1-9(2)15(17)12-5-11-6-13(8-12)16(18,10(3)4)14(15)7-11/h9-14,17-18H,5-8H2,1-4H3 |
| InChIKey | TXSHNRZBYMSEIF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |