C28H46O4 — CID 174905992
2-ethyladamantan-2-ol;2-propan-2-yladamantan-2-ol;prop-2-enoic acid (PubChem CID 174905992) has the molecular formula C28H46O4 and a molecular weight of 446.67 g/mol. Its IUPAC name is 2-ethyladamantan-2-ol;2-propan-2-yladamantan-2-ol;prop-2-enoic acid.
| Compound Name | 2-ethyladamantan-2-ol;2-propan-2-yladamantan-2-ol;prop-2-enoic acid |
|---|---|
| PubChem CID | 174905992 |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.67 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 2-ethyladamantan-2-ol;2-propan-2-yladamantan-2-ol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CC(C)C1(O)C2CC3CC(C2)CC1C3.CCC1(O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H22O.C12H20O.C3H4O2/c1-8(2)13(14)11-4-9-3-10(6-11)7-12(13)5-9;1-2-12(13)10-4-8-3-9(6-10)7-11(12)5-8;1-2-3(4)5/h8-12,14H,3-7H2,1-2H3;8-11,13H,2-7H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | CHKNDFMBVGCDOA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.67 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|