C17H20FN3O3 — CID 139816096
N-[[(2R)-4-(3-fluoro-4-piperazin-1-ylphenyl)-5-oxo-2H-furan-2-yl]methyl]acetamide (PubChem CID 139816096) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is N-[[(2R)-4-(3-fluoro-4-piperazin-1-ylphenyl)-5-oxo-2H-furan-2-yl]methyl]acetamide.
| Compound Name | N-[[(2R)-4-(3-fluoro-4-piperazin-1-ylphenyl)-5-oxo-2H-furan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 139816096 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[[(2R)-4-(3-fluoro-4-piperazin-1-ylphenyl)-5-oxo-2H-furan-2-yl]methyl]acetamide |
| SMILES | CC(=O)NC[C@H]1C=C(c2ccc(N3CCNCC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H20FN3O3/c1-11(22)20-10-13-9-14(17(23)24-13)12-2-3-16(15(18)8-12)21-6-4-19-5-7-21/h2-3,8-9,13,19H,4-7,10H2,1H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | YTXHYAWENTWUCX-CYBMUJFWSA-N |
| XLogP | 0.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|