C21H25N3O6 — CID 67652560
[2-[4-[4-[(2R)-2-(acetamidomethyl)-5-oxo-2H-furan-4-yl]phenyl]piperazin-1-yl]-2-oxoethyl] acetate (PubChem CID 67652560) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-[4-[4-[(2R)-2-(acetamidomethyl)-5-oxo-2H-furan-4-yl]phenyl]piperazin-1-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[4-[4-[(2R)-2-(acetamidomethyl)-5-oxo-2H-furan-4-yl]phenyl]piperazin-1-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 67652560 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [2-[4-[4-[(2R)-2-(acetamidomethyl)-5-oxo-2H-furan-4-yl]phenyl]piperazin-1-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)NC[C@H]1C=C(c2ccc(N3CCN(C(=O)COC(C)=O)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C21H25N3O6/c1-14(25)22-12-18-11-19(21(28)30-18)16-3-5-17(6-4-16)23-7-9-24(10-8-23)20(27)13-29-15(2)26/h3-6,11,18H,7-10,12-13H2,1-2H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | OXEKRZCTZFSXFS-GOSISDBHSA-N |
| XLogP | 0.34 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|