C39H50FN5O8S — CID 139816580
[3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-(4-fluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl] methanesulfonate (PubChem CID 139816580) has the molecular formula C39H50FN5O8S and a molecular weight of 767.92 g/mol. Its IUPAC name is [3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-(4-fluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl] methanesulfonate.
| Compound Name | [3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-(4-fluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 139816580 |
| Molecular Formula | C39H50FN5O8S |
| Molecular Weight | 767.92 g/mol |
| Exact Mass | 767.34 |
| IUPAC Name | [3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-(4-fluorophenyl)-1-(3,4,5-trimethoxybenzoyl)pyrrolidin-2-yl] methanesulfonate |
| SMILES | CCOCCn1c(NC2CCN(CCC3(c4ccc(F)cc4)CCN(C(=O)c4cc(OC)c(OC)c(OC)c4)C3OS(C)(=O)=O)CC2)nc2ccccc21 |
| InChI | InChI=1S/C39H50FN5O8S/c1-6-52-24-23-44-32-10-8-7-9-31(32)42-38(44)41-30-15-19-43(20-16-30)21-17-39(28-11-13-29(40)14-12-28)18-22-45(37(39)53-54(5,47)48)36(46)27-25-33(49-2)35(51-4)34(26-27)50-3/h7-14,25-26,30,37H,6,15-24H2,1-5H3,(H,41,42) |
| InChIKey | GAKCDZAMIBAGNG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.92 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|