C37H45F3N6O3 — CID 162547883
[3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-[2-methoxy-5-(trifluoromethylamino)phenyl]methanone (PubChem CID 162547883) has the molecular formula C37H45F3N6O3 and a molecular weight of 678.80 g/mol. Its IUPAC name is [3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-[2-methoxy-5-(trifluoromethylamino)phenyl]methanone.
| Compound Name | [3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-[2-methoxy-5-(trifluoromethylamino)phenyl]methanone |
|---|---|
| PubChem CID | 162547883 |
| Molecular Formula | C37H45F3N6O3 |
| Molecular Weight | 678.80 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | [3-[2-[4-[[1-(2-ethoxyethyl)benzimidazol-2-yl]amino]piperidin-1-yl]ethyl]-3-phenylpyrrolidin-1-yl]-[2-methoxy-5-(trifluoromethylamino)phenyl]methanone |
| SMILES | CCOCCn1c(NC2CCN(CCC3(c4ccccc4)CCN(C(=O)c4cc(NC(F)(F)F)ccc4OC)C3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C37H45F3N6O3/c1-3-49-24-23-46-32-12-8-7-11-31(32)42-35(46)41-28-15-19-44(20-16-28)21-17-36(27-9-5-4-6-10-27)18-22-45(26-36)34(47)30-25-29(43-37(38,39)40)13-14-33(30)48-2/h4-14,25,28,43H,3,15-24,26H2,1-2H3,(H,41,42) |
| InChIKey | VPDNXJBQXFZUDW-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.80 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|