C37H47N5O6S — CID 22096340
[3-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-4-methoxyphenyl] methanesulfonate (PubChem CID 22096340) has the molecular formula C37H47N5O6S and a molecular weight of 689.88 g/mol. Its IUPAC name is [3-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-4-methoxyphenyl] methanesulfonate.
| Compound Name | [3-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-4-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 22096340 |
| Molecular Formula | C37H47N5O6S |
| Molecular Weight | 689.88 g/mol |
| Exact Mass | 689.32 |
| IUPAC Name | [3-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-4-methoxyphenyl] methanesulfonate |
| SMILES | CCOCCn1c(N2CCCN(CCC3(c4ccccc4)CCN(C(=O)c4cc(OS(C)(=O)=O)ccc4OC)C3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C37H47N5O6S/c1-4-47-26-25-42-33-14-9-8-13-32(33)38-36(42)40-20-10-19-39(23-24-40)21-17-37(29-11-6-5-7-12-29)18-22-41(28-37)35(43)31-27-30(48-49(3,44)45)15-16-34(31)46-2/h5-9,11-16,27H,4,10,17-26,28H2,1-3H3 |
| InChIKey | KYXJTUZNROHVRK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 106.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.88 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|