C37H45Cl2N5O2S — CID 18464750
[3-(3,4-dichlorophenyl)-3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]pyrrolidin-1-yl]-(2-methoxy-5-methylphenyl)methanethione (PubChem CID 18464750) has the molecular formula C37H45Cl2N5O2S and a molecular weight of 694.77 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]pyrrolidin-1-yl]-(2-methoxy-5-methylphenyl)methanethione.
| Compound Name | [3-(3,4-dichlorophenyl)-3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]pyrrolidin-1-yl]-(2-methoxy-5-methylphenyl)methanethione |
|---|---|
| PubChem CID | 18464750 |
| Molecular Formula | C37H45Cl2N5O2S |
| Molecular Weight | 694.77 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-3-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]-1,4-diazepan-1-yl]ethyl]pyrrolidin-1-yl]-(2-methoxy-5-methylphenyl)methanethione |
| SMILES | CCOCCn1c(N2CCCN(CCC3(c4ccc(Cl)c(Cl)c4)CCN(C(=S)c4cc(C)ccc4OC)C3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C37H45Cl2N5O2S/c1-4-46-23-22-44-33-9-6-5-8-32(33)40-36(44)42-17-7-16-41(20-21-42)18-14-37(28-11-12-30(38)31(39)25-28)15-19-43(26-37)35(47)29-24-27(2)10-13-34(29)45-3/h5-6,8-13,24-25H,4,7,14-23,26H2,1-3H3 |
| InChIKey | JWOUQAAGHGBKPH-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 46.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.77 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|