C42H52N4O7 — CID 18333524
[6-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazole-2-carbonyl]piperidin-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-2-ethyl-3,4-dimethoxyphenyl] acetate (PubChem CID 18333524) has the molecular formula C42H52N4O7 and a molecular weight of 724.90 g/mol. Its IUPAC name is [6-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazole-2-carbonyl]piperidin-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-2-ethyl-3,4-dimethoxyphenyl] acetate.
| Compound Name | [6-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazole-2-carbonyl]piperidin-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-2-ethyl-3,4-dimethoxyphenyl] acetate |
|---|---|
| PubChem CID | 18333524 |
| Molecular Formula | C42H52N4O7 |
| Molecular Weight | 724.90 g/mol |
| Exact Mass | 724.38 |
| IUPAC Name | [6-[3-[2-[4-[1-(2-ethoxyethyl)benzimidazole-2-carbonyl]piperidin-1-yl]ethyl]-3-phenylpyrrolidine-1-carbonyl]-2-ethyl-3,4-dimethoxyphenyl] acetate |
| SMILES | CCOCCn1c(C(=O)C2CCN(CCC3(c4ccccc4)CCN(C(=O)c4cc(OC)c(OC)c(CC)c4OC(C)=O)C3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C42H52N4O7/c1-6-32-38(53-29(3)47)33(27-36(50-4)39(32)51-5)41(49)45-24-20-42(28-45,31-13-9-8-10-14-31)19-23-44-21-17-30(18-22-44)37(48)40-43-34-15-11-12-16-35(34)46(40)25-26-52-7-2/h8-16,27,30H,6-7,17-26,28H2,1-5H3 |
| InChIKey | MFCCRJWDONUULJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 112.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.90 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|