C15H27F3N2O2S — CID 139816891
1,2-dicyclohexyl-1-(trifluoromethylsulfonyl)ethane-1,2-diamine (PubChem CID 139816891) has the molecular formula C15H27F3N2O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1,2-dicyclohexyl-1-(trifluoromethylsulfonyl)ethane-1,2-diamine.
| Compound Name | 1,2-dicyclohexyl-1-(trifluoromethylsulfonyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 139816891 |
| Molecular Formula | C15H27F3N2O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1,2-dicyclohexyl-1-(trifluoromethylsulfonyl)ethane-1,2-diamine |
| SMILES | NC(C1CCCCC1)C(N)(C1CCCCC1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H27F3N2O2S/c16-15(17,18)23(21,22)14(20,12-9-5-2-6-10-12)13(19)11-7-3-1-4-8-11/h11-13H,1-10,19-20H2 |
| InChIKey | LYQWFGXMCKJDCD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |