C14H25F2NO2S — CID 105168795
(4,4-difluorocyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine (PubChem CID 105168795) has the molecular formula C14H25F2NO2S and a molecular weight of 309.42 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine.
| Compound Name | (4,4-difluorocyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 105168795 |
| Molecular Formula | C14H25F2NO2S |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(3-methylsulfonylcyclohexyl)methanamine |
| SMILES | CS(=O)(=O)C1CCCC(C(N)C2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C14H25F2NO2S/c1-20(18,19)12-4-2-3-11(9-12)13(17)10-5-7-14(15,16)8-6-10/h10-13H,2-9,17H2,1H3 |
| InChIKey | JVOOCWCBSMQPTR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |