C14H25F2NO3S — CID 148725123
3-amino-4-(6,6-difluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-1-sulfonic acid (PubChem CID 148725123) has the molecular formula C14H25F2NO3S and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-amino-4-(6,6-difluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-1-sulfonic acid.
| Compound Name | 3-amino-4-(6,6-difluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 148725123 |
| Molecular Formula | C14H25F2NO3S |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-amino-4-(6,6-difluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-1-sulfonic acid |
| SMILES | CC1CC2CC(CC(N)CCS(=O)(=O)O)CC(C2)C1(F)F |
| InChI | InChI=1S/C14H25F2NO3S/c1-9-4-10-5-11(7-12(6-10)14(9,15)16)8-13(17)2-3-21(18,19)20/h9-13H,2-8,17H2,1H3,(H,18,19,20) |
| InChIKey | NZVVDDJQBMGTAY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|