C14H21F6NO5S2 — CID 156554612
3-[2-(3-bicyclo[3.3.1]nonanyl)ethylsulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 156554612) has the molecular formula C14H21F6NO5S2 and a molecular weight of 461.45 g/mol. Its IUPAC name is 3-[2-(3-bicyclo[3.3.1]nonanyl)ethylsulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[2-(3-bicyclo[3.3.1]nonanyl)ethylsulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 156554612 |
| Molecular Formula | C14H21F6NO5S2 |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 3-[2-(3-bicyclo[3.3.1]nonanyl)ethylsulfamoyl]-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NCCC1CC2CCCC(C2)C1 |
| InChI | InChI=1S/C14H21F6NO5S2/c15-12(16,14(19,20)28(24,25)26)13(17,18)27(22,23)21-5-4-11-7-9-2-1-3-10(6-9)8-11/h9-11,21H,1-8H2,(H,24,25,26) |
| InChIKey | YTGOPFGYUHMNJL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|