C14H26FNO3S — CID 149053840
4-amino-1-(1-fluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-2-sulfonic acid (PubChem CID 149053840) has the molecular formula C14H26FNO3S and a molecular weight of 307.43 g/mol. Its IUPAC name is 4-amino-1-(1-fluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-2-sulfonic acid.
| Compound Name | 4-amino-1-(1-fluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-2-sulfonic acid |
|---|---|
| PubChem CID | 149053840 |
| Molecular Formula | C14H26FNO3S |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 4-amino-1-(1-fluoro-7-methyl-3-bicyclo[3.3.1]nonanyl)butane-2-sulfonic acid |
| SMILES | CC1CC2CC(CC(CCN)S(=O)(=O)O)CC(F)(C1)C2 |
| InChI | InChI=1S/C14H26FNO3S/c1-10-4-11-5-12(9-14(15,7-10)8-11)6-13(2-3-16)20(17,18)19/h10-13H,2-9,16H2,1H3,(H,17,18,19) |
| InChIKey | QKIKRDLKXYJVFN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|