C14H24FNO3S — CID 11594672
4-amino-1-[(5S,7R)-3-fluoro-1-adamantyl]butane-2-sulfonic acid (PubChem CID 11594672) has the molecular formula C14H24FNO3S and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-amino-1-[(5S,7R)-3-fluoro-1-adamantyl]butane-2-sulfonic acid.
| Compound Name | 4-amino-1-[(5S,7R)-3-fluoro-1-adamantyl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 11594672 |
| Molecular Formula | C14H24FNO3S |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 4-amino-1-[(5S,7R)-3-fluoro-1-adamantyl]butane-2-sulfonic acid |
| SMILES | NCCC(CC12C[C@@H]3C[C@@H](CC(F)(C3)C1)C2)S(=O)(=O)O |
| InChI | InChI=1S/C14H24FNO3S/c15-14-6-10-3-11(7-14)5-13(4-10,9-14)8-12(1-2-16)20(17,18)19/h10-12H,1-9,16H2,(H,17,18,19)/t10-,11+,12?,13?,14? |
| InChIKey | ZRBKPKUWOYVZEG-BTSKDQLBSA-N |
| XLogP | 2.29 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|