C15H26FNO3S — CID 58692035
(2R)-3-[(3,5-dimethyl-1-adamantyl)amino]-2-fluoropropane-1-sulfonic acid (PubChem CID 58692035) has the molecular formula C15H26FNO3S and a molecular weight of 319.44 g/mol. Its IUPAC name is (2R)-3-[(3,5-dimethyl-1-adamantyl)amino]-2-fluoropropane-1-sulfonic acid.
| Compound Name | (2R)-3-[(3,5-dimethyl-1-adamantyl)amino]-2-fluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58692035 |
| Molecular Formula | C15H26FNO3S |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2R)-3-[(3,5-dimethyl-1-adamantyl)amino]-2-fluoropropane-1-sulfonic acid |
| SMILES | CC12CC3CC(C)(C1)CC(NC[C@@H](F)CS(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C15H26FNO3S/c1-13-3-11-4-14(2,8-13)10-15(5-11,9-13)17-6-12(16)7-21(18,19)20/h11-12,17H,3-10H2,1-2H3,(H,18,19,20)/t11?,12-,13?,14?,15?/m1/s1 |
| InChIKey | MAMUEZGZDFXISE-HLTWPCROSA-N |
| XLogP | 2.55 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|