C14H27NO3S — CID 147028461
2-(aminomethyl)-3-(7-methyl-2-bicyclo[3.3.1]nonanyl)propane-1-sulfonic acid (PubChem CID 147028461) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(7-methyl-2-bicyclo[3.3.1]nonanyl)propane-1-sulfonic acid.
| Compound Name | 2-(aminomethyl)-3-(7-methyl-2-bicyclo[3.3.1]nonanyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 147028461 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-(aminomethyl)-3-(7-methyl-2-bicyclo[3.3.1]nonanyl)propane-1-sulfonic acid |
| SMILES | CC1CC2CCC(CC(CN)CS(=O)(=O)O)C(C1)C2 |
| InChI | InChI=1S/C14H27NO3S/c1-10-4-11-2-3-13(14(5-10)6-11)7-12(8-15)9-19(16,17)18/h10-14H,2-9,15H2,1H3,(H,16,17,18) |
| InChIKey | AXCQSJHXCIBPDR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|