C24H23N3O3 — CID 139817016
methyl N-[2-(2-methylphenyl)-3-(prop-2-enoxymethyl)imidazo[2,1-a]isoquinolin-9-yl]carbamate (PubChem CID 139817016) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is methyl N-[2-(2-methylphenyl)-3-(prop-2-enoxymethyl)imidazo[2,1-a]isoquinolin-9-yl]carbamate.
| Compound Name | methyl N-[2-(2-methylphenyl)-3-(prop-2-enoxymethyl)imidazo[2,1-a]isoquinolin-9-yl]carbamate |
|---|---|
| PubChem CID | 139817016 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | methyl N-[2-(2-methylphenyl)-3-(prop-2-enoxymethyl)imidazo[2,1-a]isoquinolin-9-yl]carbamate |
| SMILES | C=CCOCc1c(-c2ccccc2C)nc2c3cc(NC(=O)OC)ccc3ccn12 |
| InChI | InChI=1S/C24H23N3O3/c1-4-13-30-15-21-22(19-8-6-5-7-16(19)2)26-23-20-14-18(25-24(28)29-3)10-9-17(20)11-12-27(21)23/h4-12,14H,1,13,15H2,2-3H3,(H,25,28) |
| InChIKey | VITIZYODKKTBIM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|