C12H13NO3 — CID 139818724
5-methoxy-3-[(1S)-1-phenylethyl]-1,3-oxazol-2-one (PubChem CID 139818724) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-methoxy-3-[(1S)-1-phenylethyl]-1,3-oxazol-2-one.
| Compound Name | 5-methoxy-3-[(1S)-1-phenylethyl]-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 139818724 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 5-methoxy-3-[(1S)-1-phenylethyl]-1,3-oxazol-2-one |
| SMILES | COc1cn([C@@H](C)c2ccccc2)c(=O)o1 |
| InChI | InChI=1S/C12H13NO3/c1-9(10-6-4-3-5-7-10)13-8-11(15-2)16-12(13)14/h3-9H,1-2H3/t9-/m0/s1 |
| InChIKey | YJUVYYBAPHJZEL-VIFPVBQESA-N |
| XLogP | 2.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |