C14H18N4O2 — CID 139821931
methyl (2S)-3-(1H-imidazol-5-yl)-2-[(3-methyl-2-pyridinyl)methylamino]propanoate (PubChem CID 139821931) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl (2S)-3-(1H-imidazol-5-yl)-2-[(3-methyl-2-pyridinyl)methylamino]propanoate.
| Compound Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-[(3-methyl-2-pyridinyl)methylamino]propanoate |
|---|---|
| PubChem CID | 139821931 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | methyl (2S)-3-(1H-imidazol-5-yl)-2-[(3-methyl-2-pyridinyl)methylamino]propanoate |
| SMILES | COC(=O)[C@H](Cc1cnc[nH]1)NCc1ncccc1C |
| InChI | InChI=1S/C14H18N4O2/c1-10-4-3-5-16-13(10)8-17-12(14(19)20-2)6-11-7-15-9-18-11/h3-5,7,9,12,17H,6,8H2,1-2H3,(H,15,18)/t12-/m0/s1 |
| InChIKey | CEAQSIBUNAMKTQ-LBPRGKRZSA-N |
| XLogP | 0.99 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |