C25H23F2N — CID 139823028
4-[6-(4-ethylcyclohexyl)-1-fluoronaphthalen-2-yl]-2-fluorobenzonitrile (PubChem CID 139823028) has the molecular formula C25H23F2N and a molecular weight of 375.46 g/mol. Its IUPAC name is 4-[6-(4-ethylcyclohexyl)-1-fluoronaphthalen-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[6-(4-ethylcyclohexyl)-1-fluoronaphthalen-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 139823028 |
| Molecular Formula | C25H23F2N |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 4-[6-(4-ethylcyclohexyl)-1-fluoronaphthalen-2-yl]-2-fluorobenzonitrile |
| SMILES | CCC1CCC(c2ccc3c(F)c(-c4ccc(C#N)c(F)c4)ccc3c2)CC1 |
| InChI | InChI=1S/C25H23F2N/c1-2-16-3-5-17(6-4-16)18-9-11-22-19(13-18)10-12-23(25(22)27)20-7-8-21(15-28)24(26)14-20/h7-14,16-17H,2-6H2,1H3 |
| InChIKey | FWRRMTSSHDUHAU-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |