C20H27N3O4 — CID 139824301
3-[[2-[3-oxo-2-(2-piperidin-1-ylethyl)-1H-isoindol-5-yl]acetyl]amino]propanoic acid (PubChem CID 139824301) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-[[2-[3-oxo-2-(2-piperidin-1-ylethyl)-1H-isoindol-5-yl]acetyl]amino]propanoic acid.
| Compound Name | 3-[[2-[3-oxo-2-(2-piperidin-1-ylethyl)-1H-isoindol-5-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139824301 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3-[[2-[3-oxo-2-(2-piperidin-1-ylethyl)-1H-isoindol-5-yl]acetyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)Cc1ccc2c(c1)C(=O)N(CCN1CCCCC1)C2 |
| InChI | InChI=1S/C20H27N3O4/c24-18(21-7-6-19(25)26)13-15-4-5-16-14-23(20(27)17(16)12-15)11-10-22-8-2-1-3-9-22/h4-5,12H,1-3,6-11,13-14H2,(H,21,24)(H,25,26) |
| InChIKey | GFQZHNLQELBCDT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |