C10H19N3O2 — CID 139825301
tert-butyl 4-amino-2-iminopiperidine-1-carboxylate (PubChem CID 139825301) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is tert-butyl 4-amino-2-iminopiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-amino-2-iminopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139825301 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | tert-butyl 4-amino-2-iminopiperidine-1-carboxylate |
| SMILES | [H]/N=C1\CC(N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N3O2/c1-10(2,3)15-9(14)13-5-4-7(11)6-8(13)12/h7,12H,4-6,11H2,1-3H3/b12-8+ |
| InChIKey | CCSNXQBFIVPSAP-XYOKQWHBSA-N |
| XLogP | 1.32 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|