C11H23ClN4O2 — CID 66718899
carbamimidoyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azanium chloride (PubChem CID 66718899) has the molecular formula C11H23ClN4O2 and a molecular weight of 278.78 g/mol. Its IUPAC name is carbamimidoyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azanium chloride.
| Compound Name | carbamimidoyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azanium chloride |
|---|---|
| PubChem CID | 66718899 |
| Molecular Formula | C11H23ClN4O2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | carbamimidoyl-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]azanium chloride |
| SMILES | [Cl-].[H]/N=C(\N)[NH2+]C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C11H22N4O2.ClH/c1-11(2,3)17-10(16)15-6-4-8(5-7-15)14-9(12)13;/h8H,4-7H2,1-3H3,(H4,12,13,14);1H |
| InChIKey | HYZASXQVPHIDOS-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|