C13H13F3O4 — CID 139826733
1-O-ethyl 3-O-[2-(2,3,4-trifluorophenyl)ethyl] propanedioate (PubChem CID 139826733) has the molecular formula C13H13F3O4 and a molecular weight of 290.24 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[2-(2,3,4-trifluorophenyl)ethyl] propanedioate.
| Compound Name | 1-O-ethyl 3-O-[2-(2,3,4-trifluorophenyl)ethyl] propanedioate |
|---|---|
| PubChem CID | 139826733 |
| Molecular Formula | C13H13F3O4 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-O-ethyl 3-O-[2-(2,3,4-trifluorophenyl)ethyl] propanedioate |
| SMILES | CCOC(=O)CC(=O)OCCc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H13F3O4/c1-2-19-10(17)7-11(18)20-6-5-8-3-4-9(14)13(16)12(8)15/h3-4H,2,5-7H2,1H3 |
| InChIKey | DHAMOIWZYKKXKG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|