C27H20N2O6 — CID 139827057
5-(3,4-dimethoxyphenyl)-7-(pyridin-4-ylmethyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione (PubChem CID 139827057) has the molecular formula C27H20N2O6 and a molecular weight of 468.47 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-7-(pyridin-4-ylmethyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione.
| Compound Name | 5-(3,4-dimethoxyphenyl)-7-(pyridin-4-ylmethyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione |
|---|---|
| PubChem CID | 139827057 |
| Molecular Formula | C27H20N2O6 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-7-(pyridin-4-ylmethyl)-[1,3]benzodioxolo[6,5-f]isoindole-6,8-dione |
| SMILES | COc1ccc(-c2c3c(cc4cc5c(cc24)OCO5)C(=O)N(Cc2ccncc2)C3=O)cc1OC |
| InChI | InChI=1S/C27H20N2O6/c1-32-20-4-3-16(10-21(20)33-2)24-18-12-23-22(34-14-35-23)11-17(18)9-19-25(24)27(31)29(26(19)30)13-15-5-7-28-8-6-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | YCMHJBWLXPCGSC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|