C35H39N3O7S — CID 139827681
propan-2-yl (3S)-3-benzyl-4-[[(2R,4R)-3-[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoyl]-2-phenyl-1,3-thiazolidin-4-yl]amino]-2,4-dioxobutanoate (PubChem CID 139827681) has the molecular formula C35H39N3O7S and a molecular weight of 645.78 g/mol. Its IUPAC name is propan-2-yl (3S)-3-benzyl-4-[[(2R,4R)-3-[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoyl]-2-phenyl-1,3-thiazolidin-4-yl]amino]-2,4-dioxobutanoate.
| Compound Name | propan-2-yl (3S)-3-benzyl-4-[[(2R,4R)-3-[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoyl]-2-phenyl-1,3-thiazolidin-4-yl]amino]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 139827681 |
| Molecular Formula | C35H39N3O7S |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | propan-2-yl (3S)-3-benzyl-4-[[(2R,4R)-3-[(2S)-2-[methyl(phenylmethoxycarbonyl)amino]propanoyl]-2-phenyl-1,3-thiazolidin-4-yl]amino]-2,4-dioxobutanoate |
| SMILES | CC(C)OC(=O)C(=O)[C@H](Cc1ccccc1)C(=O)N[C@H]1CS[C@H](c2ccccc2)N1C(=O)[C@H](C)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H39N3O7S/c1-23(2)45-34(42)30(39)28(20-25-14-8-5-9-15-25)31(40)36-29-22-46-33(27-18-12-7-13-19-27)38(29)32(41)24(3)37(4)35(43)44-21-26-16-10-6-11-17-26/h5-19,23-24,28-29,33H,20-22H2,1-4H3,(H,36,40)/t24-,28-,29+,33+/m0/s1 |
| InChIKey | GALYXKPLLNYJJO-TVUVWNOWSA-N |
| XLogP | 4.74 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|