C34H37N3O7S — CID 139827714
propan-2-yl (3S)-3-benzyl-2,4-dioxo-4-[[(4R)-3-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]-1,3-thiazolidin-4-yl]amino]butanoate (PubChem CID 139827714) has the molecular formula C34H37N3O7S and a molecular weight of 631.75 g/mol. Its IUPAC name is propan-2-yl (3S)-3-benzyl-2,4-dioxo-4-[[(4R)-3-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]-1,3-thiazolidin-4-yl]amino]butanoate.
| Compound Name | propan-2-yl (3S)-3-benzyl-2,4-dioxo-4-[[(4R)-3-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]-1,3-thiazolidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 139827714 |
| Molecular Formula | C34H37N3O7S |
| Molecular Weight | 631.75 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | propan-2-yl (3S)-3-benzyl-2,4-dioxo-4-[[(4R)-3-[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]-1,3-thiazolidin-4-yl]amino]butanoate |
| SMILES | CC(C)OC(=O)C(=O)[C@H](Cc1ccccc1)C(=O)N[C@H]1CSCN1C(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H37N3O7S/c1-23(2)44-33(41)30(38)27(18-24-12-6-3-7-13-24)31(39)36-29-21-45-22-37(29)32(40)28(19-25-14-8-4-9-15-25)35-34(42)43-20-26-16-10-5-11-17-26/h3-17,23,27-29H,18-22H2,1-2H3,(H,35,42)(H,36,39)/t27-,28-,29+/m0/s1 |
| InChIKey | WDIANPZLEVJHRY-YTCPBCGMSA-N |
| XLogP | 3.88 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|