C19H20O5 — CID 139828190
[5-ethoxy-2-(7-hydroxy-3,4-dihydro-2H-chromen-2-yl)phenyl] acetate (PubChem CID 139828190) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is [5-ethoxy-2-(7-hydroxy-3,4-dihydro-2H-chromen-2-yl)phenyl] acetate.
| Compound Name | [5-ethoxy-2-(7-hydroxy-3,4-dihydro-2H-chromen-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 139828190 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [5-ethoxy-2-(7-hydroxy-3,4-dihydro-2H-chromen-2-yl)phenyl] acetate |
| SMILES | CCOc1ccc(C2CCc3ccc(O)cc3O2)c(OC(C)=O)c1 |
| InChI | InChI=1S/C19H20O5/c1-3-22-15-7-8-16(19(11-15)23-12(2)20)17-9-5-13-4-6-14(21)10-18(13)24-17/h4,6-8,10-11,17,21H,3,5,9H2,1-2H3 |
| InChIKey | SEIYEPMKWBDCFY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|