C20H18N2O2 — CID 139830038
(2,2-diisocyanato-1-phenylcyclohexyl)benzene (PubChem CID 139830038) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is (2,2-diisocyanato-1-phenylcyclohexyl)benzene.
| Compound Name | (2,2-diisocyanato-1-phenylcyclohexyl)benzene |
|---|---|
| PubChem CID | 139830038 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (2,2-diisocyanato-1-phenylcyclohexyl)benzene |
| SMILES | O=C=NC1(N=C=O)CCCCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H18N2O2/c23-15-21-20(22-16-24)14-8-7-13-19(20,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12H,7-8,13-14H2 |
| InChIKey | VOUXROJHGZTZCF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|