C20H18F3N3O3 — CID 139832949
4-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide (PubChem CID 139832949) has the molecular formula C20H18F3N3O3 and a molecular weight of 405.38 g/mol. Its IUPAC name is 4-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide.
| Compound Name | 4-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide |
|---|---|
| PubChem CID | 139832949 |
| Molecular Formula | C20H18F3N3O3 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 4-cyclopropyl-2-[4-(trifluoromethoxy)phenyl]-1H-pyrazolo[4,3-c]isoquinolin-1-ium-3-ol hydroxide |
| SMILES | OC1=C2C(=c3ccccc3=CN2C2CC2)[NH2+]N1c1ccc(OC(F)(F)F)cc1.[OH-] |
| InChI | InChI=1S/C20H16F3N3O2.H2O/c21-20(22,23)28-15-9-7-14(8-10-15)26-19(27)18-17(24-26)16-4-2-1-3-12(16)11-25(18)13-5-6-13;/h1-4,7-11,13,24,27H,5-6H2;1H2 |
| InChIKey | GCLPFEPNXNLONH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|