C5H5N3 — CID 139833633
7H-pyrrolo[2,1-c][1,2,4]triazole (PubChem CID 139833633) has the molecular formula C5H5N3 and a molecular weight of 107.12 g/mol. Its IUPAC name is 7H-pyrrolo[2,1-c][1,2,4]triazole.
| Compound Name | 7H-pyrrolo[2,1-c][1,2,4]triazole |
|---|---|
| PubChem CID | 139833633 |
| Molecular Formula | C5H5N3 |
| Molecular Weight | 107.12 g/mol |
| Exact Mass | 107.05 |
| IUPAC Name | 7H-pyrrolo[2,1-c][1,2,4]triazole |
| SMILES | C1=Cn2cnnc2C1 |
| InChI | InChI=1S/C5H5N3/c1-2-5-7-6-4-8(5)3-1/h1,3-4H,2H2 |
| InChIKey | ZISHVBXXIBZDTE-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 107.12 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |