C10H23N3O — CID 139833638
(NE)-N-[1-(4-aminobutylamino)-2-methylpentan-3-ylidene]hydroxylamine (PubChem CID 139833638) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is (NE)-N-[1-(4-aminobutylamino)-2-methylpentan-3-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(4-aminobutylamino)-2-methylpentan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 139833638 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | (NE)-N-[1-(4-aminobutylamino)-2-methylpentan-3-ylidene]hydroxylamine |
| SMILES | CC/C(=N\O)C(C)CNCCCCN |
| InChI | InChI=1S/C10H23N3O/c1-3-10(13-14)9(2)8-12-7-5-4-6-11/h9,12,14H,3-8,11H2,1-2H3/b13-10+ |
| InChIKey | XQEJEWVVBSOPAM-JLHYYAGUSA-N |
| XLogP | 1.19 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|