C11H28N4 — CID 159145188
2-[(7-aminoheptylamino)methyl]propane-1,3-diamine (PubChem CID 159145188) has the molecular formula C11H28N4 and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-[(7-aminoheptylamino)methyl]propane-1,3-diamine.
| Compound Name | 2-[(7-aminoheptylamino)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 159145188 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | 2-[(7-aminoheptylamino)methyl]propane-1,3-diamine |
| SMILES | NCCCCCCCNCC(CN)CN |
| InChI | InChI=1S/C11H28N4/c12-6-4-2-1-3-5-7-15-10-11(8-13)9-14/h11,15H,1-10,12-14H2 |
| InChIKey | QBTMIDZTXAWJET-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|