C19H44N4O — CID 21130743
N,N'-bis(4-aminobutyl)-2-(6-ethoxyhexyl)propane-1,3-diamine (PubChem CID 21130743) has the molecular formula C19H44N4O and a molecular weight of 344.59 g/mol. Its IUPAC name is N,N'-bis(4-aminobutyl)-2-(6-ethoxyhexyl)propane-1,3-diamine.
| Compound Name | N,N'-bis(4-aminobutyl)-2-(6-ethoxyhexyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 21130743 |
| Molecular Formula | C19H44N4O |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.35 |
| IUPAC Name | N,N'-bis(4-aminobutyl)-2-(6-ethoxyhexyl)propane-1,3-diamine |
| SMILES | CCOCCCCCCC(CNCCCCN)CNCCCCN |
| InChI | InChI=1S/C19H44N4O/c1-2-24-16-10-4-3-5-11-19(17-22-14-8-6-12-20)18-23-15-9-7-13-21/h19,22-23H,2-18,20-21H2,1H3 |
| InChIKey | HGMACPUJHNRKGC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|