C25H55N5O — CID 89060292
N-[8-(4-aminobutylamino)-7-[(4-aminobutylamino)methyl]octyl]-4-methylheptanamide (PubChem CID 89060292) has the molecular formula C25H55N5O and a molecular weight of 441.75 g/mol. Its IUPAC name is N-[8-(4-aminobutylamino)-7-[(4-aminobutylamino)methyl]octyl]-4-methylheptanamide.
| Compound Name | N-[8-(4-aminobutylamino)-7-[(4-aminobutylamino)methyl]octyl]-4-methylheptanamide |
|---|---|
| PubChem CID | 89060292 |
| Molecular Formula | C25H55N5O |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.44 |
| IUPAC Name | N-[8-(4-aminobutylamino)-7-[(4-aminobutylamino)methyl]octyl]-4-methylheptanamide |
| SMILES | CCCC(C)CCC(=O)NCCCCCCC(CNCCCCN)CNCCCCN |
| InChI | InChI=1S/C25H55N5O/c1-3-12-23(2)14-15-25(31)30-20-9-5-4-6-13-24(21-28-18-10-7-16-26)22-29-19-11-8-17-27/h23-24,28-29H,3-22,26-27H2,1-2H3,(H,30,31) |
| InChIKey | RBAYSIDSHMFBGE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|