C18H40N2O2 — CID 156819608
N'-[4-(3-methylbutoxy)butoxymethyl]octane-1,8-diamine (PubChem CID 156819608) has the molecular formula C18H40N2O2 and a molecular weight of 316.53 g/mol. Its IUPAC name is N'-[4-(3-methylbutoxy)butoxymethyl]octane-1,8-diamine.
| Compound Name | N'-[4-(3-methylbutoxy)butoxymethyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 156819608 |
| Molecular Formula | C18H40N2O2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | N'-[4-(3-methylbutoxy)butoxymethyl]octane-1,8-diamine |
| SMILES | CC(C)CCOCCCCOCNCCCCCCCCN |
| InChI | InChI=1S/C18H40N2O2/c1-18(2)11-16-21-14-9-10-15-22-17-20-13-8-6-4-3-5-7-12-19/h18,20H,3-17,19H2,1-2H3 |
| InChIKey | UFDDQAAIJWRCTP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|