C16H35O7P — CID 139834676
3-[3-(3-butoxybutan-2-yloxy)butan-2-yloxy]butan-2-yl dihydrogen phosphate (PubChem CID 139834676) has the molecular formula C16H35O7P and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-[3-(3-butoxybutan-2-yloxy)butan-2-yloxy]butan-2-yl dihydrogen phosphate.
| Compound Name | 3-[3-(3-butoxybutan-2-yloxy)butan-2-yloxy]butan-2-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 139834676 |
| Molecular Formula | C16H35O7P |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3-[3-(3-butoxybutan-2-yloxy)butan-2-yloxy]butan-2-yl dihydrogen phosphate |
| SMILES | CCCCOC(C)C(C)OC(C)C(C)OC(C)C(C)OP(=O)(O)O |
| InChI | InChI=1S/C16H35O7P/c1-8-9-10-20-11(2)12(3)21-13(4)14(5)22-15(6)16(7)23-24(17,18)19/h11-16H,8-10H2,1-7H3,(H2,17,18,19) |
| InChIKey | LMRYZYRJGPDEPI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|