About benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide
benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide (PubChem CID 139835897) has the molecular formula C50H52BP
and a molecular weight of 694.75 g/mol. Its IUPAC name is benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide.
Molecular Properties
| Compound Name | benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide |
| PubChem CID | 139835897 |
| Molecular Formula | C50H52BP |
| Molecular Weight | 694.75 g/mol |
| Exact Mass | 694.39 |
| IUPAC Name | benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide |
| SMILES | CCCC[B-](c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H30B.C25H22P/c1-5-6-19-26(23-13-7-20(2)8-14-23,24-15-9-21(3)10-16-24)25-17-11-22(4)12-18-25;1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h7-18H,5-6,19H2,1-4H3;1-20H,21H2/q-1;+1 |
| InChIKey | MKSUMPHVKDPZFL-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.75 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide?
The IUPAC name of benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide (CID 139835897) is benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide.
What is the SMILES notation for benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide?
The canonical SMILES for benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide is CCCC[B-](c1ccc(C)cc1)(c1ccc(C)cc1)c1ccc(C)cc1.c1ccc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide?
The InChIKey is MKSUMPHVKDPZFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30B.C25H22P/c1-5-6-19-26(23-13-7-20(2)8-14-23,24-15-9-21(3)10-16-24)25-17-11-22(4)12-18-25;1-5-13-22(14-6-1)21-26(23-15-7-2-8-16-23,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h7-18H,5-6,19H2,1-4H3;1-20H,21H2/q-1;+1.
What are the key properties of benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide?
benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide has a molecular weight of 694.75 g/mol, XLogP of 10.06, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(triphenyl)phosphanium;butyl-tris(4-methylphenyl)boranuide is sourced from PubChem (CID 139835897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).