C17H15ClN2O2S — CID 139836237
2-chloro-N-[5-cyano-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide (PubChem CID 139836237) has the molecular formula C17H15ClN2O2S and a molecular weight of 346.84 g/mol. Its IUPAC name is 2-chloro-N-[5-cyano-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide.
| Compound Name | 2-chloro-N-[5-cyano-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 139836237 |
| Molecular Formula | C17H15ClN2O2S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 2-chloro-N-[5-cyano-2-[(4-methoxyphenyl)methylsulfanyl]phenyl]acetamide |
| SMILES | COc1ccc(CSc2ccc(C#N)cc2NC(=O)CCl)cc1 |
| InChI | InChI=1S/C17H15ClN2O2S/c1-22-14-5-2-12(3-6-14)11-23-16-7-4-13(10-19)8-15(16)20-17(21)9-18/h2-8H,9,11H2,1H3,(H,20,21) |
| InChIKey | BNWUTPNROZWOBX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|