C21H33NO — CID 139836605
5-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-1-propylcyclohexa-2,4-dien-1-ol (PubChem CID 139836605) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 5-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-1-propylcyclohexa-2,4-dien-1-ol.
| Compound Name | 5-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-1-propylcyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 139836605 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 5-[[[(E)-6,6-dimethylhept-2-en-4-ynyl]-ethylamino]methyl]-1-propylcyclohexa-2,4-dien-1-ol |
| SMILES | CCCC1(O)C=CC=C(CN(CC)C/C=C/C#CC(C)(C)C)C1 |
| InChI | InChI=1S/C21H33NO/c1-6-13-21(23)15-11-12-19(17-21)18-22(7-2)16-10-8-9-14-20(3,4)5/h8,10-12,15,23H,6-7,13,16-18H2,1-5H3/b10-8+ |
| InChIKey | SHERNXTUGKIHOI-CSKARUKUSA-N |
| XLogP | 4.33 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|