C19H29NO — CID 168912848
(2S)-4-[(3Z,5E)-deca-3,5-dien-8-yn-5-yl]-2-methyl-1-prop-2-enylpiperidin-4-ol (PubChem CID 168912848) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (2S)-4-[(3Z,5E)-deca-3,5-dien-8-yn-5-yl]-2-methyl-1-prop-2-enylpiperidin-4-ol.
| Compound Name | (2S)-4-[(3Z,5E)-deca-3,5-dien-8-yn-5-yl]-2-methyl-1-prop-2-enylpiperidin-4-ol |
|---|---|
| PubChem CID | 168912848 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S)-4-[(3Z,5E)-deca-3,5-dien-8-yn-5-yl]-2-methyl-1-prop-2-enylpiperidin-4-ol |
| SMILES | C=CCN1CCC(O)(C(/C=C\CC)=C/CC#CC)C[C@@H]1C |
| InChI | InChI=1S/C19H29NO/c1-5-8-10-12-18(11-9-6-2)19(21)13-15-20(14-7-3)17(4)16-19/h7,9,11-12,17,21H,3,6,10,13-16H2,1-2,4H3/b11-9-,18-12+/t17-,19?/m0/s1 |
| InChIKey | SKDVTMXILBXHDR-UYSKIAKBSA-N |
| XLogP | 3.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|