C14H23NO — CID 143658534
1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-ol (PubChem CID 143658534) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-ol.
| Compound Name | 1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 143658534 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-ethyl-4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]piperidin-4-ol |
| SMILES | C=C/C=C(\C=C/C)C1(O)CCN(CC)CC1 |
| InChI | InChI=1S/C14H23NO/c1-4-7-13(8-5-2)14(16)9-11-15(6-3)12-10-14/h4-5,7-8,16H,1,6,9-12H2,2-3H3/b8-5-,13-7+ |
| InChIKey | YHPVRHKPWRFNRO-AXBOXZAGSA-N |
| XLogP | 2.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|