C17H31NO — CID 143617059
ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylpiperidin-4-ol (PubChem CID 143617059) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylpiperidin-4-ol.
| Compound Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylpiperidin-4-ol |
|---|---|
| PubChem CID | 143617059 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-propylpiperidin-4-ol |
| SMILES | C=C/C=C(\C=C/C)C1(O)CCN(CCC)CC1.CC |
| InChI | InChI=1S/C15H25NO.C2H6/c1-4-7-14(8-5-2)15(17)9-12-16(11-6-3)13-10-15;1-2/h4-5,7-8,17H,1,6,9-13H2,2-3H3;1-2H3/b8-5-,14-7+; |
| InChIKey | NLLRUVDAQRDFGG-HRAZISOHSA-N |
| XLogP | 3.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|