C18H27NO — CID 90902227
4-cyclohepta-1,4-dien-1-yl-1-hexa-1,3-dien-3-ylpiperidin-4-ol (PubChem CID 90902227) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 4-cyclohepta-1,4-dien-1-yl-1-hexa-1,3-dien-3-ylpiperidin-4-ol.
| Compound Name | 4-cyclohepta-1,4-dien-1-yl-1-hexa-1,3-dien-3-ylpiperidin-4-ol |
|---|---|
| PubChem CID | 90902227 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 4-cyclohepta-1,4-dien-1-yl-1-hexa-1,3-dien-3-ylpiperidin-4-ol |
| SMILES | C=CC(=CCC)N1CCC(O)(C2=CCC=CCC2)CC1 |
| InChI | InChI=1S/C18H27NO/c1-3-9-17(4-2)19-14-12-18(20,13-15-19)16-10-7-5-6-8-11-16/h4-6,9-10,20H,2-3,7-8,11-15H2,1H3 |
| InChIKey | VBEZDPZBVSEMLO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|