C17H29NO — CID 177235048
1-[(2E,6E)-5-ethylnona-2,4,6-trien-2-yl]-4-methylpiperidin-4-ol (PubChem CID 177235048) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 1-[(2E,6E)-5-ethylnona-2,4,6-trien-2-yl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[(2E,6E)-5-ethylnona-2,4,6-trien-2-yl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 177235048 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-[(2E,6E)-5-ethylnona-2,4,6-trien-2-yl]-4-methylpiperidin-4-ol |
| SMILES | CC/C=C/C(=C/C=C(\C)N1CCC(C)(O)CC1)CC |
| InChI | InChI=1S/C17H29NO/c1-5-7-8-16(6-2)10-9-15(3)18-13-11-17(4,19)12-14-18/h7-10,19H,5-6,11-14H2,1-4H3/b8-7+,15-9+,16-10? |
| InChIKey | YPZNJUVXIONMBB-DPDOOCFXSA-N |
| XLogP | 4.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|