C19H29ClN2O — CID 89256483
1-[(2E,4E)-5-amino-6-methylhepta-2,4,6-trien-2-yl]-4-[(3E)-4-chlorohexa-3,5-dienyl]piperidin-4-ol (PubChem CID 89256483) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is 1-[(2E,4E)-5-amino-6-methylhepta-2,4,6-trien-2-yl]-4-[(3E)-4-chlorohexa-3,5-dienyl]piperidin-4-ol.
| Compound Name | 1-[(2E,4E)-5-amino-6-methylhepta-2,4,6-trien-2-yl]-4-[(3E)-4-chlorohexa-3,5-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 89256483 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[(2E,4E)-5-amino-6-methylhepta-2,4,6-trien-2-yl]-4-[(3E)-4-chlorohexa-3,5-dienyl]piperidin-4-ol |
| SMILES | C=C/C(Cl)=C\CCC1(O)CCN(/C(C)=C/C=C(/N)C(=C)C)CC1 |
| InChI | InChI=1S/C19H29ClN2O/c1-5-17(20)7-6-10-19(23)11-13-22(14-12-19)16(4)8-9-18(21)15(2)3/h5,7-9,23H,1-2,6,10-14,21H2,3-4H3/b16-8+,17-7+,18-9+ |
| InChIKey | ZPTSEYOXUTUGJS-SNHNKHJOSA-N |
| XLogP | 4.22 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|