C14H20N2O4S2 — CID 139839926
2-[tert-butylsulfonyl(diazo)methyl]sulfonyl-1,3,5-trimethylbenzene (PubChem CID 139839926) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[tert-butylsulfonyl(diazo)methyl]sulfonyl-1,3,5-trimethylbenzene.
| Compound Name | 2-[tert-butylsulfonyl(diazo)methyl]sulfonyl-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 139839926 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[tert-butylsulfonyl(diazo)methyl]sulfonyl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(S(=O)(=O)C(=[N+]=[N-])S(=O)(=O)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-9-7-10(2)12(11(3)8-9)21(17,18)13(16-15)22(19,20)14(4,5)6/h7-8H,1-6H3 |
| InChIKey | QTRXHURNIPKGEV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|