C23H18N2O2 — CID 139841121
1-[2-(3-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]ethanone (PubChem CID 139841121) has the molecular formula C23H18N2O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[2-(3-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]ethanone.
| Compound Name | 1-[2-(3-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 139841121 |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1-[2-(3-hydroxyphenyl)-4,5-diphenylimidazol-1-yl]ethanone |
| SMILES | CC(=O)n1c(-c2cccc(O)c2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C23H18N2O2/c1-16(26)25-22(18-11-6-3-7-12-18)21(17-9-4-2-5-10-17)24-23(25)19-13-8-14-20(27)15-19/h2-15,27H,1H3 |
| InChIKey | PHADZKYYOXJJBI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |